C23H27NO7S — CID 66791379
[2-[4-(4-methoxyphenoxy)phenyl]sulfonyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-1-yl] hydrogen carbonate (PubChem CID 66791379) has the molecular formula C23H27NO7S and a molecular weight of 461.54 g/mol. Its IUPAC name is [2-[4-(4-methoxyphenoxy)phenyl]sulfonyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-1-yl] hydrogen carbonate.
| Compound Name | [2-[4-(4-methoxyphenoxy)phenyl]sulfonyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-1-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 66791379 |
| Molecular Formula | C23H27NO7S |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | [2-[4-(4-methoxyphenoxy)phenyl]sulfonyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-1-yl] hydrogen carbonate |
| SMILES | COc1ccc(Oc2ccc(S(=O)(=O)N3CCC4CCCCC4C3OC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C23H27NO7S/c1-29-17-6-8-18(9-7-17)30-19-10-12-20(13-11-19)32(27,28)24-15-14-16-4-2-3-5-21(16)22(24)31-23(25)26/h6-13,16,21-22H,2-5,14-15H2,1H3,(H,25,26) |
| InChIKey | OHKKMIVUMYDJFV-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |