C12H16N2O4S2 — CID 18411977
3-(4-methoxyphenyl)sulfonyl-1,3-thiazinane-2-carboxamide (PubChem CID 18411977) has the molecular formula C12H16N2O4S2 and a molecular weight of 316.40 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)sulfonyl-1,3-thiazinane-2-carboxamide.
| Compound Name | 3-(4-methoxyphenyl)sulfonyl-1,3-thiazinane-2-carboxamide |
|---|---|
| PubChem CID | 18411977 |
| Molecular Formula | C12H16N2O4S2 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 3-(4-methoxyphenyl)sulfonyl-1,3-thiazinane-2-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCCSC2C(N)=O)cc1 |
| InChI | InChI=1S/C12H16N2O4S2/c1-18-9-3-5-10(6-4-9)20(16,17)14-7-2-8-19-12(14)11(13)15/h3-6,12H,2,7-8H2,1H3,(H2,13,15) |
| InChIKey | GUEADQBSBIFDLR-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |