C14H19NO4S2 — CID 15895345
S-[[(2R)-1-(4-methoxyphenyl)sulfonylpyrrolidin-2-yl]methyl] ethanethioate (PubChem CID 15895345) has the molecular formula C14H19NO4S2 and a molecular weight of 329.44 g/mol. Its IUPAC name is S-[[(2R)-1-(4-methoxyphenyl)sulfonylpyrrolidin-2-yl]methyl] ethanethioate.
| Compound Name | S-[[(2R)-1-(4-methoxyphenyl)sulfonylpyrrolidin-2-yl]methyl] ethanethioate |
|---|---|
| PubChem CID | 15895345 |
| Molecular Formula | C14H19NO4S2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | S-[[(2R)-1-(4-methoxyphenyl)sulfonylpyrrolidin-2-yl]methyl] ethanethioate |
| SMILES | COc1ccc(S(=O)(=O)N2CCC[C@@H]2CSC(C)=O)cc1 |
| InChI | InChI=1S/C14H19NO4S2/c1-11(16)20-10-12-4-3-9-15(12)21(17,18)14-7-5-13(19-2)6-8-14/h5-8,12H,3-4,9-10H2,1-2H3/t12-/m1/s1 |
| InChIKey | YBIYAIXERMJWNN-GFCCVEGCSA-N |
| XLogP | 2.13 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|