C15H21NO5S2 — CID 3729057
methyl 3-(4-butoxyphenyl)sulfonyl-1,3-thiazolidine-2-carboxylate (PubChem CID 3729057) has the molecular formula C15H21NO5S2 and a molecular weight of 359.47 g/mol. Its IUPAC name is methyl 3-(4-butoxyphenyl)sulfonyl-1,3-thiazolidine-2-carboxylate.
| Compound Name | methyl 3-(4-butoxyphenyl)sulfonyl-1,3-thiazolidine-2-carboxylate |
|---|---|
| PubChem CID | 3729057 |
| Molecular Formula | C15H21NO5S2 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | methyl 3-(4-butoxyphenyl)sulfonyl-1,3-thiazolidine-2-carboxylate |
| SMILES | CCCCOc1ccc(S(=O)(=O)N2CCSC2C(=O)OC)cc1 |
| InChI | InChI=1S/C15H21NO5S2/c1-3-4-10-21-12-5-7-13(8-6-12)23(18,19)16-9-11-22-14(16)15(17)20-2/h5-8,14H,3-4,9-11H2,1-2H3 |
| InChIKey | YPJNYIKOYHACJC-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|