C19H22ClNO3S2 — CID 7157484
(2S)-3-(4-butoxyphenyl)sulfonyl-2-(2-chlorophenyl)-1,3-thiazolidine (PubChem CID 7157484) has the molecular formula C19H22ClNO3S2 and a molecular weight of 411.98 g/mol. Its IUPAC name is (2S)-3-(4-butoxyphenyl)sulfonyl-2-(2-chlorophenyl)-1,3-thiazolidine.
| Compound Name | (2S)-3-(4-butoxyphenyl)sulfonyl-2-(2-chlorophenyl)-1,3-thiazolidine |
|---|---|
| PubChem CID | 7157484 |
| Molecular Formula | C19H22ClNO3S2 |
| Molecular Weight | 411.98 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | (2S)-3-(4-butoxyphenyl)sulfonyl-2-(2-chlorophenyl)-1,3-thiazolidine |
| SMILES | CCCCOc1ccc(S(=O)(=O)N2CCS[C@H]2c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C19H22ClNO3S2/c1-2-3-13-24-15-8-10-16(11-9-15)26(22,23)21-12-14-25-19(21)17-6-4-5-7-18(17)20/h4-11,19H,2-3,12-14H2,1H3/t19-/m0/s1 |
| InChIKey | GRYMCBPYSMJGJB-IBGZPJMESA-N |
| XLogP | 4.96 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.98 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|