C19H29NO4S2 — CID 59050229
1-[(3S)-4-(4-butoxyphenyl)sulfonyl-2,2-dimethyl-1,4-thiazepan-3-yl]ethanone (PubChem CID 59050229) has the molecular formula C19H29NO4S2 and a molecular weight of 399.58 g/mol. Its IUPAC name is 1-[(3S)-4-(4-butoxyphenyl)sulfonyl-2,2-dimethyl-1,4-thiazepan-3-yl]ethanone.
| Compound Name | 1-[(3S)-4-(4-butoxyphenyl)sulfonyl-2,2-dimethyl-1,4-thiazepan-3-yl]ethanone |
|---|---|
| PubChem CID | 59050229 |
| Molecular Formula | C19H29NO4S2 |
| Molecular Weight | 399.58 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 1-[(3S)-4-(4-butoxyphenyl)sulfonyl-2,2-dimethyl-1,4-thiazepan-3-yl]ethanone |
| SMILES | CCCCOc1ccc(S(=O)(=O)N2CCCSC(C)(C)[C@@H]2C(C)=O)cc1 |
| InChI | InChI=1S/C19H29NO4S2/c1-5-6-13-24-16-8-10-17(11-9-16)26(22,23)20-12-7-14-25-19(3,4)18(20)15(2)21/h8-11,18H,5-7,12-14H2,1-4H3/t18-/m0/s1 |
| InChIKey | PGCVDIDPNRORFZ-SFHVURJKSA-N |
| XLogP | 3.73 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.58 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|