C22H28N2O5S2 — CID 54558705
butyl 2,2-dimethyl-4-(4-pyridin-4-yloxyphenyl)sulfonylthiomorpholine-3-carboxylate (PubChem CID 54558705) has the molecular formula C22H28N2O5S2 and a molecular weight of 464.61 g/mol. Its IUPAC name is butyl 2,2-dimethyl-4-(4-pyridin-4-yloxyphenyl)sulfonylthiomorpholine-3-carboxylate.
| Compound Name | butyl 2,2-dimethyl-4-(4-pyridin-4-yloxyphenyl)sulfonylthiomorpholine-3-carboxylate |
|---|---|
| PubChem CID | 54558705 |
| Molecular Formula | C22H28N2O5S2 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | butyl 2,2-dimethyl-4-(4-pyridin-4-yloxyphenyl)sulfonylthiomorpholine-3-carboxylate |
| SMILES | CCCCOC(=O)C1N(S(=O)(=O)c2ccc(Oc3ccncc3)cc2)CCSC1(C)C |
| InChI | InChI=1S/C22H28N2O5S2/c1-4-5-15-28-21(25)20-22(2,3)30-16-14-24(20)31(26,27)19-8-6-17(7-9-19)29-18-10-12-23-13-11-18/h6-13,20H,4-5,14-16H2,1-3H3 |
| InChIKey | ZOZYOPCBJLAIGT-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 85.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|