C19H21BrN2O5S2 — CID 18659898
(3S)-4-[4-(4-bromophenoxy)phenyl]sulfonyl-N-hydroxy-2,2-dimethylthiomorpholine-3-carboxamide (PubChem CID 18659898) has the molecular formula C19H21BrN2O5S2 and a molecular weight of 501.42 g/mol. Its IUPAC name is (3S)-4-[4-(4-bromophenoxy)phenyl]sulfonyl-N-hydroxy-2,2-dimethylthiomorpholine-3-carboxamide.
| Compound Name | (3S)-4-[4-(4-bromophenoxy)phenyl]sulfonyl-N-hydroxy-2,2-dimethylthiomorpholine-3-carboxamide |
|---|---|
| PubChem CID | 18659898 |
| Molecular Formula | C19H21BrN2O5S2 |
| Molecular Weight | 501.42 g/mol |
| Exact Mass | 500.01 |
| IUPAC Name | (3S)-4-[4-(4-bromophenoxy)phenyl]sulfonyl-N-hydroxy-2,2-dimethylthiomorpholine-3-carboxamide |
| SMILES | CC1(C)SCCN(S(=O)(=O)c2ccc(Oc3ccc(Br)cc3)cc2)[C@H]1C(=O)NO |
| InChI | InChI=1S/C19H21BrN2O5S2/c1-19(2)17(18(23)21-24)22(11-12-28-19)29(25,26)16-9-7-15(8-10-16)27-14-5-3-13(20)4-6-14/h3-10,17,24H,11-12H2,1-2H3,(H,21,23)/t17-/m0/s1 |
| InChIKey | UPRKSBKFZYPHBO-KRWDZBQOSA-N |
| XLogP | 3.63 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.42 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|