C20H22N2O5S2 — CID 10203252
(3S)-4-[4-(2-formylphenyl)phenyl]sulfonyl-N-hydroxy-2,2-dimethylthiomorpholine-3-carboxamide (PubChem CID 10203252) has the molecular formula C20H22N2O5S2 and a molecular weight of 434.54 g/mol. Its IUPAC name is (3S)-4-[4-(2-formylphenyl)phenyl]sulfonyl-N-hydroxy-2,2-dimethylthiomorpholine-3-carboxamide.
| Compound Name | (3S)-4-[4-(2-formylphenyl)phenyl]sulfonyl-N-hydroxy-2,2-dimethylthiomorpholine-3-carboxamide |
|---|---|
| PubChem CID | 10203252 |
| Molecular Formula | C20H22N2O5S2 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | (3S)-4-[4-(2-formylphenyl)phenyl]sulfonyl-N-hydroxy-2,2-dimethylthiomorpholine-3-carboxamide |
| SMILES | CC1(C)SCCN(S(=O)(=O)c2ccc(-c3ccccc3C=O)cc2)[C@H]1C(=O)NO |
| InChI | InChI=1S/C20H22N2O5S2/c1-20(2)18(19(24)21-25)22(11-12-28-20)29(26,27)16-9-7-14(8-10-16)17-6-4-3-5-15(17)13-23/h3-10,13,18,25H,11-12H2,1-2H3,(H,21,24)/t18-/m0/s1 |
| InChIKey | GUUXUIDCXSIVGI-SFHVURJKSA-N |
| XLogP | 2.56 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|