C19H25N3O7S2 — CID 87600462
4-[4-[3-(hydroxycarbamoyl)-2,2-dimethylthiomorpholin-4-yl]sulfonylphenoxy]but-2-ynyl-methylcarbamic acid (PubChem CID 87600462) has the molecular formula C19H25N3O7S2 and a molecular weight of 471.56 g/mol. Its IUPAC name is 4-[4-[3-(hydroxycarbamoyl)-2,2-dimethylthiomorpholin-4-yl]sulfonylphenoxy]but-2-ynyl-methylcarbamic acid.
| Compound Name | 4-[4-[3-(hydroxycarbamoyl)-2,2-dimethylthiomorpholin-4-yl]sulfonylphenoxy]but-2-ynyl-methylcarbamic acid |
|---|---|
| PubChem CID | 87600462 |
| Molecular Formula | C19H25N3O7S2 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | 4-[4-[3-(hydroxycarbamoyl)-2,2-dimethylthiomorpholin-4-yl]sulfonylphenoxy]but-2-ynyl-methylcarbamic acid |
| SMILES | CN(CC#CCOc1ccc(S(=O)(=O)N2CCSC(C)(C)C2C(=O)NO)cc1)C(=O)O |
| InChI | InChI=1S/C19H25N3O7S2/c1-19(2)16(17(23)20-26)22(11-13-30-19)31(27,28)15-8-6-14(7-9-15)29-12-5-4-10-21(3)18(24)25/h6-9,16,26H,10-13H2,1-3H3,(H,20,23)(H,24,25) |
| InChIKey | NBYHYGSKSYRNLE-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 136.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|