C18H24N2O5S2 — CID 57093799
(3S,5S)-4-(4-but-2-ynoxyphenyl)sulfonyl-N-hydroxy-2,2,5-trimethylthiomorpholine-3-carboxamide (PubChem CID 57093799) has the molecular formula C18H24N2O5S2 and a molecular weight of 412.53 g/mol. Its IUPAC name is (3S,5S)-4-(4-but-2-ynoxyphenyl)sulfonyl-N-hydroxy-2,2,5-trimethylthiomorpholine-3-carboxamide.
| Compound Name | (3S,5S)-4-(4-but-2-ynoxyphenyl)sulfonyl-N-hydroxy-2,2,5-trimethylthiomorpholine-3-carboxamide |
|---|---|
| PubChem CID | 57093799 |
| Molecular Formula | C18H24N2O5S2 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | (3S,5S)-4-(4-but-2-ynoxyphenyl)sulfonyl-N-hydroxy-2,2,5-trimethylthiomorpholine-3-carboxamide |
| SMILES | CC#CCOc1ccc(S(=O)(=O)N2[C@@H](C(=O)NO)C(C)(C)SC[C@@H]2C)cc1 |
| InChI | InChI=1S/C18H24N2O5S2/c1-5-6-11-25-14-7-9-15(10-8-14)27(23,24)20-13(2)12-26-18(3,4)16(20)17(21)19-22/h7-10,13,16,22H,11-12H2,1-4H3,(H,19,21)/t13-,16-/m0/s1 |
| InChIKey | YAVHWPGOJXVYJG-BBRMVZONSA-N |
| XLogP | 1.87 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|