C19H25NO5S2 — CID 57123135
methyl (3S)-4-(4-but-2-ynoxyphenyl)sulfonyl-2,2,6-trimethylthiomorpholine-3-carboxylate (PubChem CID 57123135) has the molecular formula C19H25NO5S2 and a molecular weight of 411.55 g/mol. Its IUPAC name is methyl (3S)-4-(4-but-2-ynoxyphenyl)sulfonyl-2,2,6-trimethylthiomorpholine-3-carboxylate.
| Compound Name | methyl (3S)-4-(4-but-2-ynoxyphenyl)sulfonyl-2,2,6-trimethylthiomorpholine-3-carboxylate |
|---|---|
| PubChem CID | 57123135 |
| Molecular Formula | C19H25NO5S2 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | methyl (3S)-4-(4-but-2-ynoxyphenyl)sulfonyl-2,2,6-trimethylthiomorpholine-3-carboxylate |
| SMILES | CC#CCOc1ccc(S(=O)(=O)N2CC(C)SC(C)(C)[C@@H]2C(=O)OC)cc1 |
| InChI | InChI=1S/C19H25NO5S2/c1-6-7-12-25-15-8-10-16(11-9-15)27(22,23)20-13-14(2)26-19(3,4)17(20)18(21)24-5/h8-11,14,17H,12-13H2,1-5H3/t14?,17-/m0/s1 |
| InChIKey | VITRCUCAOFDEKF-JRZJBTRGSA-N |
| XLogP | 2.53 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|