C23H23FN2O6S — CID 12016497
methyl 1-acetyl-4-(4-but-2-ynoxyphenyl)sulfonyl-7-fluoro-3,5-dihydro-2H-1,4-benzodiazepine-3-carboxylate (PubChem CID 12016497) has the molecular formula C23H23FN2O6S and a molecular weight of 474.51 g/mol. Its IUPAC name is methyl 1-acetyl-4-(4-but-2-ynoxyphenyl)sulfonyl-7-fluoro-3,5-dihydro-2H-1,4-benzodiazepine-3-carboxylate.
| Compound Name | methyl 1-acetyl-4-(4-but-2-ynoxyphenyl)sulfonyl-7-fluoro-3,5-dihydro-2H-1,4-benzodiazepine-3-carboxylate |
|---|---|
| PubChem CID | 12016497 |
| Molecular Formula | C23H23FN2O6S |
| Molecular Weight | 474.51 g/mol |
| Exact Mass | 474.13 |
| IUPAC Name | methyl 1-acetyl-4-(4-but-2-ynoxyphenyl)sulfonyl-7-fluoro-3,5-dihydro-2H-1,4-benzodiazepine-3-carboxylate |
| SMILES | CC#CCOc1ccc(S(=O)(=O)N2Cc3cc(F)ccc3N(C(C)=O)CC2C(=O)OC)cc1 |
| InChI | InChI=1S/C23H23FN2O6S/c1-4-5-12-32-19-7-9-20(10-8-19)33(29,30)26-14-17-13-18(24)6-11-21(17)25(16(2)27)15-22(26)23(28)31-3/h6-11,13,22H,12,14-15H2,1-3H3 |
| InChIKey | ZNMYWXKQPDQWAU-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.51 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|