C23H25N3O7S — CID 151863230
1-acetyl-N-hydroxy-4-[4-(4-methoxybut-2-ynoxy)phenyl]sulfonyl-3,5-dihydro-2H-1,4-benzodiazepine-3-carboxamide (PubChem CID 151863230) has the molecular formula C23H25N3O7S and a molecular weight of 487.53 g/mol. Its IUPAC name is 1-acetyl-N-hydroxy-4-[4-(4-methoxybut-2-ynoxy)phenyl]sulfonyl-3,5-dihydro-2H-1,4-benzodiazepine-3-carboxamide.
| Compound Name | 1-acetyl-N-hydroxy-4-[4-(4-methoxybut-2-ynoxy)phenyl]sulfonyl-3,5-dihydro-2H-1,4-benzodiazepine-3-carboxamide |
|---|---|
| PubChem CID | 151863230 |
| Molecular Formula | C23H25N3O7S |
| Molecular Weight | 487.53 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | 1-acetyl-N-hydroxy-4-[4-(4-methoxybut-2-ynoxy)phenyl]sulfonyl-3,5-dihydro-2H-1,4-benzodiazepine-3-carboxamide |
| SMILES | COCC#CCOc1ccc(S(=O)(=O)N2Cc3ccccc3N(C(C)=O)CC2C(=O)NO)cc1 |
| InChI | InChI=1S/C23H25N3O7S/c1-17(27)25-16-22(23(28)24-29)26(15-18-7-3-4-8-21(18)25)34(30,31)20-11-9-19(10-12-20)33-14-6-5-13-32-2/h3-4,7-12,22,29H,13-16H2,1-2H3,(H,24,28) |
| InChIKey | SLDJBIFAORMUAT-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 125.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.53 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|