C24H26N2O7S — CID 18613006
4-[4-(4-methoxybut-2-ynoxy)phenyl]sulfonyl-1-propanoyl-3,5-dihydro-2H-1,4-benzodiazepine-3-carboxylic acid (PubChem CID 18613006) has the molecular formula C24H26N2O7S and a molecular weight of 486.55 g/mol. Its IUPAC name is 4-[4-(4-methoxybut-2-ynoxy)phenyl]sulfonyl-1-propanoyl-3,5-dihydro-2H-1,4-benzodiazepine-3-carboxylic acid.
| Compound Name | 4-[4-(4-methoxybut-2-ynoxy)phenyl]sulfonyl-1-propanoyl-3,5-dihydro-2H-1,4-benzodiazepine-3-carboxylic acid |
|---|---|
| PubChem CID | 18613006 |
| Molecular Formula | C24H26N2O7S |
| Molecular Weight | 486.55 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | 4-[4-(4-methoxybut-2-ynoxy)phenyl]sulfonyl-1-propanoyl-3,5-dihydro-2H-1,4-benzodiazepine-3-carboxylic acid |
| SMILES | CCC(=O)N1CC(C(=O)O)N(S(=O)(=O)c2ccc(OCC#CCOC)cc2)Cc2ccccc21 |
| InChI | InChI=1S/C24H26N2O7S/c1-3-23(27)25-17-22(24(28)29)26(16-18-8-4-5-9-21(18)25)34(30,31)20-12-10-19(11-13-20)33-15-7-6-14-32-2/h4-5,8-13,22H,3,14-17H2,1-2H3,(H,28,29) |
| InChIKey | XLGVFSNLPVTZKA-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 113.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.55 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|