C21H22N2O7S2 — CID 18612819
4-(4-but-2-ynoxyphenyl)sulfonyl-1-methylsulfonyl-3,5-dihydro-2H-1,4-benzodiazepine-3-carboxylic acid (PubChem CID 18612819) has the molecular formula C21H22N2O7S2 and a molecular weight of 478.55 g/mol. Its IUPAC name is 4-(4-but-2-ynoxyphenyl)sulfonyl-1-methylsulfonyl-3,5-dihydro-2H-1,4-benzodiazepine-3-carboxylic acid.
| Compound Name | 4-(4-but-2-ynoxyphenyl)sulfonyl-1-methylsulfonyl-3,5-dihydro-2H-1,4-benzodiazepine-3-carboxylic acid |
|---|---|
| PubChem CID | 18612819 |
| Molecular Formula | C21H22N2O7S2 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | 4-(4-but-2-ynoxyphenyl)sulfonyl-1-methylsulfonyl-3,5-dihydro-2H-1,4-benzodiazepine-3-carboxylic acid |
| SMILES | CC#CCOc1ccc(S(=O)(=O)N2Cc3ccccc3N(S(C)(=O)=O)CC2C(=O)O)cc1 |
| InChI | InChI=1S/C21H22N2O7S2/c1-3-4-13-30-17-9-11-18(12-10-17)32(28,29)23-14-16-7-5-6-8-19(16)22(31(2,26)27)15-20(23)21(24)25/h5-12,20H,13-15H2,1-2H3,(H,24,25) |
| InChIKey | REBNGQJHSOCPPJ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 121.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|