C28H26N2O7S — CID 18613055
4-(4-but-2-ynoxyphenyl)sulfonyl-1-(2-phenoxyacetyl)-3,5-dihydro-2H-1,4-benzodiazepine-3-carboxylic acid (PubChem CID 18613055) has the molecular formula C28H26N2O7S and a molecular weight of 534.59 g/mol. Its IUPAC name is 4-(4-but-2-ynoxyphenyl)sulfonyl-1-(2-phenoxyacetyl)-3,5-dihydro-2H-1,4-benzodiazepine-3-carboxylic acid.
| Compound Name | 4-(4-but-2-ynoxyphenyl)sulfonyl-1-(2-phenoxyacetyl)-3,5-dihydro-2H-1,4-benzodiazepine-3-carboxylic acid |
|---|---|
| PubChem CID | 18613055 |
| Molecular Formula | C28H26N2O7S |
| Molecular Weight | 534.59 g/mol |
| Exact Mass | 534.15 |
| IUPAC Name | 4-(4-but-2-ynoxyphenyl)sulfonyl-1-(2-phenoxyacetyl)-3,5-dihydro-2H-1,4-benzodiazepine-3-carboxylic acid |
| SMILES | CC#CCOc1ccc(S(=O)(=O)N2Cc3ccccc3N(C(=O)COc3ccccc3)CC2C(=O)O)cc1 |
| InChI | InChI=1S/C28H26N2O7S/c1-2-3-17-36-23-13-15-24(16-14-23)38(34,35)30-18-21-9-7-8-12-25(21)29(19-26(30)28(32)33)27(31)20-37-22-10-5-4-6-11-22/h4-16,26H,17-20H2,1H3,(H,32,33) |
| InChIKey | XDAPXNCIELCUTD-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 113.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.59 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|