C17H22N2O8S — CID 58612346
(2R,3S,4S,5S)-1-(4-but-2-ynoxyphenyl)sulfonyl-N,4,5-trihydroxy-3-methoxypiperidine-2-carboxamide (PubChem CID 58612346) has the molecular formula C17H22N2O8S and a molecular weight of 414.44 g/mol. Its IUPAC name is (2R,3S,4S,5S)-1-(4-but-2-ynoxyphenyl)sulfonyl-N,4,5-trihydroxy-3-methoxypiperidine-2-carboxamide.
| Compound Name | (2R,3S,4S,5S)-1-(4-but-2-ynoxyphenyl)sulfonyl-N,4,5-trihydroxy-3-methoxypiperidine-2-carboxamide |
|---|---|
| PubChem CID | 58612346 |
| Molecular Formula | C17H22N2O8S |
| Molecular Weight | 414.44 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | (2R,3S,4S,5S)-1-(4-but-2-ynoxyphenyl)sulfonyl-N,4,5-trihydroxy-3-methoxypiperidine-2-carboxamide |
| SMILES | CC#CCOc1ccc(S(=O)(=O)N2C[C@H](O)[C@H](O)[C@@H](OC)[C@@H]2C(=O)NO)cc1 |
| InChI | InChI=1S/C17H22N2O8S/c1-3-4-9-27-11-5-7-12(8-6-11)28(24,25)19-10-13(20)15(21)16(26-2)14(19)17(22)18-23/h5-8,13-16,20-21,23H,9-10H2,1-2H3,(H,18,22)/t13-,14+,15-,16-/m0/s1 |
| InChIKey | WZZROHGXDJBEMY-FZKCQIBNSA-N |
| XLogP | -1.30 |
| TPSA | 145.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.44 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|