C19H25N3O6S — CID 142651618
ethyl 1-(4-but-2-ynoxyphenyl)sulfonyl-4-(methylcarbamoyl)piperazine-2-carboxylate (PubChem CID 142651618) has the molecular formula C19H25N3O6S and a molecular weight of 423.49 g/mol. Its IUPAC name is ethyl 1-(4-but-2-ynoxyphenyl)sulfonyl-4-(methylcarbamoyl)piperazine-2-carboxylate.
| Compound Name | ethyl 1-(4-but-2-ynoxyphenyl)sulfonyl-4-(methylcarbamoyl)piperazine-2-carboxylate |
|---|---|
| PubChem CID | 142651618 |
| Molecular Formula | C19H25N3O6S |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | ethyl 1-(4-but-2-ynoxyphenyl)sulfonyl-4-(methylcarbamoyl)piperazine-2-carboxylate |
| SMILES | CC#CCOc1ccc(S(=O)(=O)N2CCN(C(=O)NC)CC2C(=O)OCC)cc1 |
| InChI | InChI=1S/C19H25N3O6S/c1-4-6-13-28-15-7-9-16(10-8-15)29(25,26)22-12-11-21(19(24)20-3)14-17(22)18(23)27-5-2/h7-10,17H,5,11-14H2,1-3H3,(H,20,24) |
| InChIKey | ZFKZQMCPWYZSCA-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|