C21H28N2O7S — CID 70089778
1-butoxycarbonyl-4-(4-but-2-ynoxyphenyl)sulfonyl-1,4-diazepane-5-carboxylic acid (PubChem CID 70089778) has the molecular formula C21H28N2O7S and a molecular weight of 452.53 g/mol. Its IUPAC name is 1-butoxycarbonyl-4-(4-but-2-ynoxyphenyl)sulfonyl-1,4-diazepane-5-carboxylic acid.
| Compound Name | 1-butoxycarbonyl-4-(4-but-2-ynoxyphenyl)sulfonyl-1,4-diazepane-5-carboxylic acid |
|---|---|
| PubChem CID | 70089778 |
| Molecular Formula | C21H28N2O7S |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | 1-butoxycarbonyl-4-(4-but-2-ynoxyphenyl)sulfonyl-1,4-diazepane-5-carboxylic acid |
| SMILES | CC#CCOc1ccc(S(=O)(=O)N2CCN(C(=O)OCCCC)CCC2C(=O)O)cc1 |
| InChI | InChI=1S/C21H28N2O7S/c1-3-5-15-29-17-7-9-18(10-8-17)31(27,28)23-14-13-22(12-11-19(23)20(24)25)21(26)30-16-6-4-2/h7-10,19H,4,6,11-16H2,1-2H3,(H,24,25) |
| InChIKey | KRDXFLSXBWWKIA-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 113.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|