C24H30N2O10S2 — CID 11376547
1-O-tert-butyl 3-O-ethyl 4-[4-(4-hydroxyphenyl)sulfonyloxyphenyl]sulfonylpiperazine-1,3-dicarboxylate (PubChem CID 11376547) has the molecular formula C24H30N2O10S2 and a molecular weight of 570.64 g/mol. Its IUPAC name is 1-O-tert-butyl 3-O-ethyl 4-[4-(4-hydroxyphenyl)sulfonyloxyphenyl]sulfonylpiperazine-1,3-dicarboxylate.
| Compound Name | 1-O-tert-butyl 3-O-ethyl 4-[4-(4-hydroxyphenyl)sulfonyloxyphenyl]sulfonylpiperazine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 11376547 |
| Molecular Formula | C24H30N2O10S2 |
| Molecular Weight | 570.64 g/mol |
| Exact Mass | 570.13 |
| IUPAC Name | 1-O-tert-butyl 3-O-ethyl 4-[4-(4-hydroxyphenyl)sulfonyloxyphenyl]sulfonylpiperazine-1,3-dicarboxylate |
| SMILES | CCOC(=O)C1CN(C(=O)OC(C)(C)C)CCN1S(=O)(=O)c1ccc(OS(=O)(=O)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C24H30N2O10S2/c1-5-34-22(28)21-16-25(23(29)35-24(2,3)4)14-15-26(21)37(30,31)19-12-8-18(9-13-19)36-38(32,33)20-10-6-17(27)7-11-20/h6-13,21,27H,5,14-16H2,1-4H3 |
| InChIKey | JKLGKOXKGANWRN-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 156.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.64 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|