C33H34N2O5S — CID 98086343
tert-butyl (3R)-4-(4-phenoxyphenyl)sulfonyl-3-(4-phenylphenyl)piperazine-1-carboxylate (PubChem CID 98086343) has the molecular formula C33H34N2O5S and a molecular weight of 570.71 g/mol. Its IUPAC name is tert-butyl (3R)-4-(4-phenoxyphenyl)sulfonyl-3-(4-phenylphenyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl (3R)-4-(4-phenoxyphenyl)sulfonyl-3-(4-phenylphenyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 98086343 |
| Molecular Formula | C33H34N2O5S |
| Molecular Weight | 570.71 g/mol |
| Exact Mass | 570.22 |
| IUPAC Name | tert-butyl (3R)-4-(4-phenoxyphenyl)sulfonyl-3-(4-phenylphenyl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(S(=O)(=O)c2ccc(Oc3ccccc3)cc2)[C@H](c2ccc(-c3ccccc3)cc2)C1 |
| InChI | InChI=1S/C33H34N2O5S/c1-33(2,3)40-32(36)34-22-23-35(31(24-34)27-16-14-26(15-17-27)25-10-6-4-7-11-25)41(37,38)30-20-18-29(19-21-30)39-28-12-8-5-9-13-28/h4-21,31H,22-24H2,1-3H3/t31-/m0/s1 |
| InChIKey | IFGUUXODQQTKHR-HKBQPEDESA-N |
| XLogP | 7.13 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.71 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |