C25H35N3O6SSi — CID 57162432
(2R)-4-acetyl-N-[tert-butyl(dimethyl)silyl]oxy-1-(4-phenoxyphenyl)sulfonylpiperazine-2-carboxamide (PubChem CID 57162432) has the molecular formula C25H35N3O6SSi and a molecular weight of 533.72 g/mol. Its IUPAC name is (2R)-4-acetyl-N-[tert-butyl(dimethyl)silyl]oxy-1-(4-phenoxyphenyl)sulfonylpiperazine-2-carboxamide.
| Compound Name | (2R)-4-acetyl-N-[tert-butyl(dimethyl)silyl]oxy-1-(4-phenoxyphenyl)sulfonylpiperazine-2-carboxamide |
|---|---|
| PubChem CID | 57162432 |
| Molecular Formula | C25H35N3O6SSi |
| Molecular Weight | 533.72 g/mol |
| Exact Mass | 533.20 |
| IUPAC Name | (2R)-4-acetyl-N-[tert-butyl(dimethyl)silyl]oxy-1-(4-phenoxyphenyl)sulfonylpiperazine-2-carboxamide |
| SMILES | CC(=O)N1CCN(S(=O)(=O)c2ccc(Oc3ccccc3)cc2)[C@@H](C(=O)NO[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C25H35N3O6SSi/c1-19(29)27-16-17-28(23(18-27)24(30)26-34-36(5,6)25(2,3)4)35(31,32)22-14-12-21(13-15-22)33-20-10-8-7-9-11-20/h7-15,23H,16-18H2,1-6H3,(H,26,30)/t23-/m1/s1 |
| InChIKey | DLAXEIPMTBLTLN-HSZRJFAPSA-N |
| XLogP | 3.75 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.72 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|