C25H35BrN2O5S2Si — CID 22592903
4-[4-(4-bromophenoxy)phenyl]sulfonyl-N-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylthiomorpholine-3-carboxamide (PubChem CID 22592903) has the molecular formula C25H35BrN2O5S2Si and a molecular weight of 615.69 g/mol. Its IUPAC name is 4-[4-(4-bromophenoxy)phenyl]sulfonyl-N-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylthiomorpholine-3-carboxamide.
| Compound Name | 4-[4-(4-bromophenoxy)phenyl]sulfonyl-N-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylthiomorpholine-3-carboxamide |
|---|---|
| PubChem CID | 22592903 |
| Molecular Formula | C25H35BrN2O5S2Si |
| Molecular Weight | 615.69 g/mol |
| Exact Mass | 614.09 |
| IUPAC Name | 4-[4-(4-bromophenoxy)phenyl]sulfonyl-N-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylthiomorpholine-3-carboxamide |
| SMILES | CC1(C)SCCN(S(=O)(=O)c2ccc(Oc3ccc(Br)cc3)cc2)C1C(=O)NO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H35BrN2O5S2Si/c1-24(2,3)36(6,7)33-27-23(29)22-25(4,5)34-17-16-28(22)35(30,31)21-14-12-20(13-15-21)32-19-10-8-18(26)9-11-19/h8-15,22H,16-17H2,1-7H3,(H,27,29) |
| InChIKey | RUMPOLKGNVDZJA-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.69 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|