C21H26N2O5S2 — CID 10527560
(3S)-N-hydroxy-N,2,2-trimethyl-4-(4-phenoxyphenyl)sulfonyl-1,4-thiazepane-3-carboxamide (PubChem CID 10527560) has the molecular formula C21H26N2O5S2 and a molecular weight of 450.58 g/mol. Its IUPAC name is (3S)-N-hydroxy-N,2,2-trimethyl-4-(4-phenoxyphenyl)sulfonyl-1,4-thiazepane-3-carboxamide.
| Compound Name | (3S)-N-hydroxy-N,2,2-trimethyl-4-(4-phenoxyphenyl)sulfonyl-1,4-thiazepane-3-carboxamide |
|---|---|
| PubChem CID | 10527560 |
| Molecular Formula | C21H26N2O5S2 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | (3S)-N-hydroxy-N,2,2-trimethyl-4-(4-phenoxyphenyl)sulfonyl-1,4-thiazepane-3-carboxamide |
| SMILES | CN(O)C(=O)[C@@H]1N(S(=O)(=O)c2ccc(Oc3ccccc3)cc2)CCCSC1(C)C |
| InChI | InChI=1S/C21H26N2O5S2/c1-21(2)19(20(24)22(3)25)23(14-7-15-29-21)30(26,27)18-12-10-17(11-13-18)28-16-8-5-4-6-9-16/h4-6,8-13,19,25H,7,14-15H2,1-3H3/t19-/m0/s1 |
| InChIKey | OSVBRBFAGFUIKL-IBGZPJMESA-N |
| XLogP | 3.60 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|