C20H27NO7S — CID 22464316
4-[4-(4-hydroxyhex-2-ynoxy)phenyl]sulfonyl-2,2,6-trimethylmorpholine-3-carboxylic acid (PubChem CID 22464316) has the molecular formula C20H27NO7S and a molecular weight of 425.50 g/mol. Its IUPAC name is 4-[4-(4-hydroxyhex-2-ynoxy)phenyl]sulfonyl-2,2,6-trimethylmorpholine-3-carboxylic acid.
| Compound Name | 4-[4-(4-hydroxyhex-2-ynoxy)phenyl]sulfonyl-2,2,6-trimethylmorpholine-3-carboxylic acid |
|---|---|
| PubChem CID | 22464316 |
| Molecular Formula | C20H27NO7S |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 4-[4-(4-hydroxyhex-2-ynoxy)phenyl]sulfonyl-2,2,6-trimethylmorpholine-3-carboxylic acid |
| SMILES | CCC(O)C#CCOc1ccc(S(=O)(=O)N2CC(C)OC(C)(C)C2C(=O)O)cc1 |
| InChI | InChI=1S/C20H27NO7S/c1-5-15(22)7-6-12-27-16-8-10-17(11-9-16)29(25,26)21-13-14(2)28-20(3,4)18(21)19(23)24/h8-11,14-15,18,22H,5,12-13H2,1-4H3,(H,23,24) |
| InChIKey | XBXHMVYOGHTEOW-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|