C18H22N2O8S — CID 22464286
4-[4-(4-methoxybut-2-ynoxy)phenyl]sulfonyl-2-methylpiperazine-1,3-dicarboxylic acid (PubChem CID 22464286) has the molecular formula C18H22N2O8S and a molecular weight of 426.45 g/mol. Its IUPAC name is 4-[4-(4-methoxybut-2-ynoxy)phenyl]sulfonyl-2-methylpiperazine-1,3-dicarboxylic acid.
| Compound Name | 4-[4-(4-methoxybut-2-ynoxy)phenyl]sulfonyl-2-methylpiperazine-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 22464286 |
| Molecular Formula | C18H22N2O8S |
| Molecular Weight | 426.45 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | 4-[4-(4-methoxybut-2-ynoxy)phenyl]sulfonyl-2-methylpiperazine-1,3-dicarboxylic acid |
| SMILES | COCC#CCOc1ccc(S(=O)(=O)N2CCN(C(=O)O)C(C)C2C(=O)O)cc1 |
| InChI | InChI=1S/C18H22N2O8S/c1-13-16(17(21)22)20(10-9-19(13)18(23)24)29(25,26)15-7-5-14(6-8-15)28-12-4-3-11-27-2/h5-8,13,16H,9-12H2,1-2H3,(H,21,22)(H,23,24) |
| InChIKey | SQPARRNDSPDZEY-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 133.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.45 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|