C18H24N2O7S2 — CID 22464265
3-methyl-4-methylsulfonyl-1-(4-pent-3-yn-2-yloxyphenyl)sulfonylpiperazine-2-carboxylic acid (PubChem CID 22464265) has the molecular formula C18H24N2O7S2 and a molecular weight of 444.53 g/mol. Its IUPAC name is 3-methyl-4-methylsulfonyl-1-(4-pent-3-yn-2-yloxyphenyl)sulfonylpiperazine-2-carboxylic acid.
| Compound Name | 3-methyl-4-methylsulfonyl-1-(4-pent-3-yn-2-yloxyphenyl)sulfonylpiperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 22464265 |
| Molecular Formula | C18H24N2O7S2 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | 3-methyl-4-methylsulfonyl-1-(4-pent-3-yn-2-yloxyphenyl)sulfonylpiperazine-2-carboxylic acid |
| SMILES | CC#CC(C)Oc1ccc(S(=O)(=O)N2CCN(S(C)(=O)=O)C(C)C2C(=O)O)cc1 |
| InChI | InChI=1S/C18H24N2O7S2/c1-5-6-13(2)27-15-7-9-16(10-8-15)29(25,26)20-12-11-19(28(4,23)24)14(3)17(20)18(21)22/h7-10,13-14,17H,11-12H2,1-4H3,(H,21,22) |
| InChIKey | MROZKNIIPLMEKY-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 121.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|