C15H19F2NO4S — CID 146131415
1-[4-(difluoromethyl)phenyl]sulfonyl-2-propan-2-ylpyrrolidine-3-carboxylic acid (PubChem CID 146131415) has the molecular formula C15H19F2NO4S and a molecular weight of 347.38 g/mol. Its IUPAC name is 1-[4-(difluoromethyl)phenyl]sulfonyl-2-propan-2-ylpyrrolidine-3-carboxylic acid.
| Compound Name | 1-[4-(difluoromethyl)phenyl]sulfonyl-2-propan-2-ylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 146131415 |
| Molecular Formula | C15H19F2NO4S |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 1-[4-(difluoromethyl)phenyl]sulfonyl-2-propan-2-ylpyrrolidine-3-carboxylic acid |
| SMILES | CC(C)C1C(C(=O)O)CCN1S(=O)(=O)c1ccc(C(F)F)cc1 |
| InChI | InChI=1S/C15H19F2NO4S/c1-9(2)13-12(15(19)20)7-8-18(13)23(21,22)11-5-3-10(4-6-11)14(16)17/h3-6,9,12-14H,7-8H2,1-2H3,(H,19,20) |
| InChIKey | IAKXUVXAXQJVPA-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |