1-[4-(difluoromethyl)benzoyl]piperidine-3,4-dicarboxylic acid

C15H15F2NO5 — CID 167916924

IUPAC1-[4-(difluoromethyl)benzoyl]piperidine-3,4-dicarboxylic acid
SMILESO=C(O)C1CCN(C(=O)c2ccc(C(F)F)cc2)CC1C(=O)O
InChIInChI=1S/C15H15F2NO5/c16-12(17)8-1-3-9(4-2-8)13(19)18-6-5-10(14(20)21)11(7-18)15(22)23/h1-4,10-12H,5-7H2,(H,20,21)(H,22,23)
InChIKeyQUUHCSAGSNLIHU-UHFFFAOYSA-N
MW327.28 g/mol
LogP1.87
Rot. Bonds4

About 1-[4-(difluoromethyl)benzoyl]piperidine-3,4-dicarboxylic acid

1-[4-(difluoromethyl)benzoyl]piperidine-3,4-dicarboxylic acid (PubChem CID 167916924) has the molecular formula C15H15F2NO5 and a molecular weight of 327.28 g/mol. Its IUPAC name is 1-[4-(difluoromethyl)benzoyl]piperidine-3,4-dicarboxylic acid.

Molecular Properties

Compound Name1-[4-(difluoromethyl)benzoyl]piperidine-3,4-dicarboxylic acid
PubChem CID167916924
Molecular FormulaC15H15F2NO5
Molecular Weight327.28 g/mol
Exact Mass327.09
IUPAC Name1-[4-(difluoromethyl)benzoyl]piperidine-3,4-dicarboxylic acid
SMILESO=C(O)C1CCN(C(=O)c2ccc(C(F)F)cc2)CC1C(=O)O
InChIInChI=1S/C15H15F2NO5/c16-12(17)8-1-3-9(4-2-8)13(19)18-6-5-10(14(20)21)11(7-18)15(22)23/h1-4,10-12H,5-7H2,(H,20,21)(H,22,23)
InChIKeyQUUHCSAGSNLIHU-UHFFFAOYSA-N
XLogP1.87
TPSA94.91 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500327.28
LogP ≤ 51.87
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 1-[4-(difluoromethyl)benzoyl]piperidine-3,4-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-[4-(difluoromethyl)benzoyl]piperidine-3,4-dicarboxylic acid?
The IUPAC name of 1-[4-(difluoromethyl)benzoyl]piperidine-3,4-dicarboxylic acid (CID 167916924) is 1-[4-(difluoromethyl)benzoyl]piperidine-3,4-dicarboxylic acid.
What is the SMILES notation for 1-[4-(difluoromethyl)benzoyl]piperidine-3,4-dicarboxylic acid?
The canonical SMILES for 1-[4-(difluoromethyl)benzoyl]piperidine-3,4-dicarboxylic acid is O=C(O)C1CCN(C(=O)c2ccc(C(F)F)cc2)CC1C(=O)O.
What is the InChIKey of 1-[4-(difluoromethyl)benzoyl]piperidine-3,4-dicarboxylic acid?
The InChIKey is QUUHCSAGSNLIHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15F2NO5/c16-12(17)8-1-3-9(4-2-8)13(19)18-6-5-10(14(20)21)11(7-18)15(22)23/h1-4,10-12H,5-7H2,(H,20,21)(H,22,23).
What are the key properties of 1-[4-(difluoromethyl)benzoyl]piperidine-3,4-dicarboxylic acid?
1-[4-(difluoromethyl)benzoyl]piperidine-3,4-dicarboxylic acid has a molecular weight of 327.28 g/mol, XLogP of 1.87, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(difluoromethyl)benzoyl]piperidine-3,4-dicarboxylic acid is sourced from PubChem (CID 167916924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).