C18H24N2O4 — CID 164688368
(3R,4S)-4-hydroxy-1-(4-piperidin-1-ylbenzoyl)piperidine-3-carboxylic acid (PubChem CID 164688368) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is (3R,4S)-4-hydroxy-1-(4-piperidin-1-ylbenzoyl)piperidine-3-carboxylic acid.
| Compound Name | (3R,4S)-4-hydroxy-1-(4-piperidin-1-ylbenzoyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 164688368 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | (3R,4S)-4-hydroxy-1-(4-piperidin-1-ylbenzoyl)piperidine-3-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CN(C(=O)c2ccc(N3CCCCC3)cc2)CC[C@@H]1O |
| InChI | InChI=1S/C18H24N2O4/c21-16-8-11-20(12-15(16)18(23)24)17(22)13-4-6-14(7-5-13)19-9-2-1-3-10-19/h4-7,15-16,21H,1-3,8-12H2,(H,23,24)/t15-,16+/m1/s1 |
| InChIKey | TUBDBFAJPFQBNK-CVEARBPZSA-N |
| XLogP | 1.58 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |