C16H20F2N2O3S — CID 136522204
N-cyclopentyl-1-[4-(difluoromethyl)benzoyl]azetidine-3-sulfonamide (PubChem CID 136522204) has the molecular formula C16H20F2N2O3S and a molecular weight of 358.41 g/mol. Its IUPAC name is N-cyclopentyl-1-[4-(difluoromethyl)benzoyl]azetidine-3-sulfonamide.
| Compound Name | N-cyclopentyl-1-[4-(difluoromethyl)benzoyl]azetidine-3-sulfonamide |
|---|---|
| PubChem CID | 136522204 |
| Molecular Formula | C16H20F2N2O3S |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | N-cyclopentyl-1-[4-(difluoromethyl)benzoyl]azetidine-3-sulfonamide |
| SMILES | O=C(c1ccc(C(F)F)cc1)N1CC(S(=O)(=O)NC2CCCC2)C1 |
| InChI | InChI=1S/C16H20F2N2O3S/c17-15(18)11-5-7-12(8-6-11)16(21)20-9-14(10-20)24(22,23)19-13-3-1-2-4-13/h5-8,13-15,19H,1-4,9-10H2 |
| InChIKey | CDEMROLLBBWZDJ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |