C19H22N4O3S — CID 75476264
N-cyclopentyl-1-(2-pyrimidin-5-ylbenzoyl)azetidine-3-sulfonamide (PubChem CID 75476264) has the molecular formula C19H22N4O3S and a molecular weight of 386.48 g/mol. Its IUPAC name is N-cyclopentyl-1-(2-pyrimidin-5-ylbenzoyl)azetidine-3-sulfonamide.
| Compound Name | N-cyclopentyl-1-(2-pyrimidin-5-ylbenzoyl)azetidine-3-sulfonamide |
|---|---|
| PubChem CID | 75476264 |
| Molecular Formula | C19H22N4O3S |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | N-cyclopentyl-1-(2-pyrimidin-5-ylbenzoyl)azetidine-3-sulfonamide |
| SMILES | O=C(c1ccccc1-c1cncnc1)N1CC(S(=O)(=O)NC2CCCC2)C1 |
| InChI | InChI=1S/C19H22N4O3S/c24-19(18-8-4-3-7-17(18)14-9-20-13-21-10-14)23-11-16(12-23)27(25,26)22-15-5-1-2-6-15/h3-4,7-10,13,15-16,22H,1-2,5-6,11-12H2 |
| InChIKey | ADDZCTQSWQSUTI-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |