C15H20N6O2S — CID 122139119
N-cyclopentyl-1-(1-phenyltetrazol-5-yl)azetidine-3-sulfonamide (PubChem CID 122139119) has the molecular formula C15H20N6O2S and a molecular weight of 348.43 g/mol. Its IUPAC name is N-cyclopentyl-1-(1-phenyltetrazol-5-yl)azetidine-3-sulfonamide.
| Compound Name | N-cyclopentyl-1-(1-phenyltetrazol-5-yl)azetidine-3-sulfonamide |
|---|---|
| PubChem CID | 122139119 |
| Molecular Formula | C15H20N6O2S |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | N-cyclopentyl-1-(1-phenyltetrazol-5-yl)azetidine-3-sulfonamide |
| SMILES | O=S(=O)(NC1CCCC1)C1CN(c2nnnn2-c2ccccc2)C1 |
| InChI | InChI=1S/C15H20N6O2S/c22-24(23,17-12-6-4-5-7-12)14-10-20(11-14)15-16-18-19-21(15)13-8-2-1-3-9-13/h1-3,8-9,12,14,17H,4-7,10-11H2 |
| InChIKey | FPAFOHFBPWMKMJ-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |