C20H24N6O2 — CID 133362403
N-(3,5-dimethoxyphenyl)-1-(1-phenyltetrazol-5-yl)piperidin-3-amine (PubChem CID 133362403) has the molecular formula C20H24N6O2 and a molecular weight of 380.45 g/mol. Its IUPAC name is N-(3,5-dimethoxyphenyl)-1-(1-phenyltetrazol-5-yl)piperidin-3-amine.
| Compound Name | N-(3,5-dimethoxyphenyl)-1-(1-phenyltetrazol-5-yl)piperidin-3-amine |
|---|---|
| PubChem CID | 133362403 |
| Molecular Formula | C20H24N6O2 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | N-(3,5-dimethoxyphenyl)-1-(1-phenyltetrazol-5-yl)piperidin-3-amine |
| SMILES | COc1cc(NC2CCCN(c3nnnn3-c3ccccc3)C2)cc(OC)c1 |
| InChI | InChI=1S/C20H24N6O2/c1-27-18-11-16(12-19(13-18)28-2)21-15-7-6-10-25(14-15)20-22-23-24-26(20)17-8-4-3-5-9-17/h3-5,8-9,11-13,15,21H,6-7,10,14H2,1-2H3 |
| InChIKey | YNEPYCDVKRTGMO-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 77.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |