C12H16N6 — CID 102986512
(3R)-1-(1-phenyltetrazol-5-yl)piperidin-3-amine (PubChem CID 102986512) has the molecular formula C12H16N6 and a molecular weight of 244.30 g/mol. Its IUPAC name is (3R)-1-(1-phenyltetrazol-5-yl)piperidin-3-amine.
| Compound Name | (3R)-1-(1-phenyltetrazol-5-yl)piperidin-3-amine |
|---|---|
| PubChem CID | 102986512 |
| Molecular Formula | C12H16N6 |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | (3R)-1-(1-phenyltetrazol-5-yl)piperidin-3-amine |
| SMILES | N[C@@H]1CCCN(c2nnnn2-c2ccccc2)C1 |
| InChI | InChI=1S/C12H16N6/c13-10-5-4-8-17(9-10)12-14-15-16-18(12)11-6-2-1-3-7-11/h1-3,6-7,10H,4-5,8-9,13H2/t10-/m1/s1 |
| InChIKey | GHUBERSACLPZNK-SNVBAGLBSA-N |
| XLogP | 0.59 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |