C16H18N8O2 — CID 95191744
1-[[(3R)-1-(1-phenyltetrazol-5-yl)piperidin-3-yl]methyl]triazole-4-carboxylic acid (PubChem CID 95191744) has the molecular formula C16H18N8O2 and a molecular weight of 354.37 g/mol. Its IUPAC name is 1-[[(3R)-1-(1-phenyltetrazol-5-yl)piperidin-3-yl]methyl]triazole-4-carboxylic acid.
| Compound Name | 1-[[(3R)-1-(1-phenyltetrazol-5-yl)piperidin-3-yl]methyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 95191744 |
| Molecular Formula | C16H18N8O2 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 1-[[(3R)-1-(1-phenyltetrazol-5-yl)piperidin-3-yl]methyl]triazole-4-carboxylic acid |
| SMILES | O=C(O)c1cn(C[C@@H]2CCCN(c3nnnn3-c3ccccc3)C2)nn1 |
| InChI | InChI=1S/C16H18N8O2/c25-15(26)14-11-23(20-17-14)10-12-5-4-8-22(9-12)16-18-19-21-24(16)13-6-2-1-3-7-13/h1-3,6-7,11-12H,4-5,8-10H2,(H,25,26)/t12-/m1/s1 |
| InChIKey | AHVIGVGEGFQSQE-GFCCVEGCSA-N |
| XLogP | 0.87 |
| TPSA | 114.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |