C18H18ClN5O2 — CID 56707594
1-[[1-(7-chloroquinolin-4-yl)piperidin-3-yl]methyl]triazole-4-carboxylic acid (PubChem CID 56707594) has the molecular formula C18H18ClN5O2 and a molecular weight of 371.83 g/mol. Its IUPAC name is 1-[[1-(7-chloroquinolin-4-yl)piperidin-3-yl]methyl]triazole-4-carboxylic acid.
| Compound Name | 1-[[1-(7-chloroquinolin-4-yl)piperidin-3-yl]methyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 56707594 |
| Molecular Formula | C18H18ClN5O2 |
| Molecular Weight | 371.83 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 1-[[1-(7-chloroquinolin-4-yl)piperidin-3-yl]methyl]triazole-4-carboxylic acid |
| SMILES | O=C(O)c1cn(CC2CCCN(c3ccnc4cc(Cl)ccc34)C2)nn1 |
| InChI | InChI=1S/C18H18ClN5O2/c19-13-3-4-14-15(8-13)20-6-5-17(14)23-7-1-2-12(9-23)10-24-11-16(18(25)26)21-22-24/h3-6,8,11-12H,1-2,7,9-10H2,(H,25,26) |
| InChIKey | NNHYKGLMFGYVAB-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.83 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |