C19H21N7O — CID 72904671
N-[[1-(1-phenyltetrazol-5-yl)piperidin-3-yl]methyl]pyridine-3-carboxamide (PubChem CID 72904671) has the molecular formula C19H21N7O and a molecular weight of 363.42 g/mol. Its IUPAC name is N-[[1-(1-phenyltetrazol-5-yl)piperidin-3-yl]methyl]pyridine-3-carboxamide.
| Compound Name | N-[[1-(1-phenyltetrazol-5-yl)piperidin-3-yl]methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 72904671 |
| Molecular Formula | C19H21N7O |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | N-[[1-(1-phenyltetrazol-5-yl)piperidin-3-yl]methyl]pyridine-3-carboxamide |
| SMILES | O=C(NCC1CCCN(c2nnnn2-c2ccccc2)C1)c1cccnc1 |
| InChI | InChI=1S/C19H21N7O/c27-18(16-7-4-10-20-13-16)21-12-15-6-5-11-25(14-15)19-22-23-24-26(19)17-8-2-1-3-9-17/h1-4,7-10,13,15H,5-6,11-12,14H2,(H,21,27) |
| InChIKey | RYDJZHXUBQZIIN-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 88.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |