C17H18FN3O — CID 110414295
N-[[1-(4-fluorophenyl)pyrrolidin-3-yl]methyl]pyridine-3-carboxamide (PubChem CID 110414295) has the molecular formula C17H18FN3O and a molecular weight of 299.35 g/mol. Its IUPAC name is N-[[1-(4-fluorophenyl)pyrrolidin-3-yl]methyl]pyridine-3-carboxamide.
| Compound Name | N-[[1-(4-fluorophenyl)pyrrolidin-3-yl]methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 110414295 |
| Molecular Formula | C17H18FN3O |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | N-[[1-(4-fluorophenyl)pyrrolidin-3-yl]methyl]pyridine-3-carboxamide |
| SMILES | O=C(NCC1CCN(c2ccc(F)cc2)C1)c1cccnc1 |
| InChI | InChI=1S/C17H18FN3O/c18-15-3-5-16(6-4-15)21-9-7-13(12-21)10-20-17(22)14-2-1-8-19-11-14/h1-6,8,11,13H,7,9-10,12H2,(H,20,22) |
| InChIKey | SBDSORJBUGDUNI-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |