C16H18N4O — CID 35220191
N-[[(3S)-1-phenylpyrrolidin-3-yl]methyl]pyrazine-2-carboxamide (PubChem CID 35220191) has the molecular formula C16H18N4O and a molecular weight of 282.35 g/mol. Its IUPAC name is N-[[(3S)-1-phenylpyrrolidin-3-yl]methyl]pyrazine-2-carboxamide.
| Compound Name | N-[[(3S)-1-phenylpyrrolidin-3-yl]methyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 35220191 |
| Molecular Formula | C16H18N4O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | N-[[(3S)-1-phenylpyrrolidin-3-yl]methyl]pyrazine-2-carboxamide |
| SMILES | O=C(NC[C@@H]1CCN(c2ccccc2)C1)c1cnccn1 |
| InChI | InChI=1S/C16H18N4O/c21-16(15-11-17-7-8-18-15)19-10-13-6-9-20(12-13)14-4-2-1-3-5-14/h1-5,7-8,11,13H,6,9-10,12H2,(H,19,21)/t13-/m0/s1 |
| InChIKey | DZHKFYINIPBSDD-ZDUSSCGKSA-N |
| XLogP | 1.73 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |