C12H16N4O3 — CID 154500129
4-[(pyrazine-2-carbonylamino)methyl]piperidine-1-carboxylic acid (PubChem CID 154500129) has the molecular formula C12H16N4O3 and a molecular weight of 264.28 g/mol. Its IUPAC name is 4-[(pyrazine-2-carbonylamino)methyl]piperidine-1-carboxylic acid.
| Compound Name | 4-[(pyrazine-2-carbonylamino)methyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 154500129 |
| Molecular Formula | C12H16N4O3 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 4-[(pyrazine-2-carbonylamino)methyl]piperidine-1-carboxylic acid |
| SMILES | O=C(NCC1CCN(C(=O)O)CC1)c1cnccn1 |
| InChI | InChI=1S/C12H16N4O3/c17-11(10-8-13-3-4-14-10)15-7-9-1-5-16(6-2-9)12(18)19/h3-4,8-9H,1-2,5-7H2,(H,15,17)(H,18,19) |
| InChIKey | NNUSVZJCFVLYQN-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |