C21H24N4O5 — CID 108930118
ethyl [4-[4-[(pyrazine-2-carbonylamino)methyl]piperidine-1-carbonyl]phenyl] carbonate (PubChem CID 108930118) has the molecular formula C21H24N4O5 and a molecular weight of 412.45 g/mol. Its IUPAC name is ethyl [4-[4-[(pyrazine-2-carbonylamino)methyl]piperidine-1-carbonyl]phenyl] carbonate.
| Compound Name | ethyl [4-[4-[(pyrazine-2-carbonylamino)methyl]piperidine-1-carbonyl]phenyl] carbonate |
|---|---|
| PubChem CID | 108930118 |
| Molecular Formula | C21H24N4O5 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | ethyl [4-[4-[(pyrazine-2-carbonylamino)methyl]piperidine-1-carbonyl]phenyl] carbonate |
| SMILES | CCOC(=O)Oc1ccc(C(=O)N2CCC(CNC(=O)c3cnccn3)CC2)cc1 |
| InChI | InChI=1S/C21H24N4O5/c1-2-29-21(28)30-17-5-3-16(4-6-17)20(27)25-11-7-15(8-12-25)13-24-19(26)18-14-22-9-10-23-18/h3-6,9-10,14-15H,2,7-8,11-13H2,1H3,(H,24,26) |
| InChIKey | HUIXAJXFZGJEFZ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 110.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|