C18H21F3N2O5 — CID 108929904
ethyl [4-[4-[[(2,2,2-trifluoroacetyl)amino]methyl]piperidine-1-carbonyl]phenyl] carbonate (PubChem CID 108929904) has the molecular formula C18H21F3N2O5 and a molecular weight of 402.37 g/mol. Its IUPAC name is ethyl [4-[4-[[(2,2,2-trifluoroacetyl)amino]methyl]piperidine-1-carbonyl]phenyl] carbonate.
| Compound Name | ethyl [4-[4-[[(2,2,2-trifluoroacetyl)amino]methyl]piperidine-1-carbonyl]phenyl] carbonate |
|---|---|
| PubChem CID | 108929904 |
| Molecular Formula | C18H21F3N2O5 |
| Molecular Weight | 402.37 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | ethyl [4-[4-[[(2,2,2-trifluoroacetyl)amino]methyl]piperidine-1-carbonyl]phenyl] carbonate |
| SMILES | CCOC(=O)Oc1ccc(C(=O)N2CCC(CNC(=O)C(F)(F)F)CC2)cc1 |
| InChI | InChI=1S/C18H21F3N2O5/c1-2-27-17(26)28-14-5-3-13(4-6-14)15(24)23-9-7-12(8-10-23)11-22-16(25)18(19,20)21/h3-6,12H,2,7-11H2,1H3,(H,22,25) |
| InChIKey | BNBBKYJIVRYABL-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.37 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|