C25H29ClN2O5 — CID 108930194
[4-[4-[[3-(3-chlorophenyl)propanoylamino]methyl]piperidine-1-carbonyl]phenyl] ethyl carbonate (PubChem CID 108930194) has the molecular formula C25H29ClN2O5 and a molecular weight of 472.97 g/mol. Its IUPAC name is [4-[4-[[3-(3-chlorophenyl)propanoylamino]methyl]piperidine-1-carbonyl]phenyl] ethyl carbonate.
| Compound Name | [4-[4-[[3-(3-chlorophenyl)propanoylamino]methyl]piperidine-1-carbonyl]phenyl] ethyl carbonate |
|---|---|
| PubChem CID | 108930194 |
| Molecular Formula | C25H29ClN2O5 |
| Molecular Weight | 472.97 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | [4-[4-[[3-(3-chlorophenyl)propanoylamino]methyl]piperidine-1-carbonyl]phenyl] ethyl carbonate |
| SMILES | CCOC(=O)Oc1ccc(C(=O)N2CCC(CNC(=O)CCc3cccc(Cl)c3)CC2)cc1 |
| InChI | InChI=1S/C25H29ClN2O5/c1-2-32-25(31)33-22-9-7-20(8-10-22)24(30)28-14-12-19(13-15-28)17-27-23(29)11-6-18-4-3-5-21(26)16-18/h3-5,7-10,16,19H,2,6,11-15,17H2,1H3,(H,27,29) |
| InChIKey | ZXBUOHIOWFYZNW-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.97 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|