C28H36N2O7 — CID 108930100
[4-[4-[[3-(4-ethoxy-3-methoxyphenyl)propanoylamino]methyl]piperidine-1-carbonyl]phenyl] ethyl carbonate (PubChem CID 108930100) has the molecular formula C28H36N2O7 and a molecular weight of 512.60 g/mol. Its IUPAC name is [4-[4-[[3-(4-ethoxy-3-methoxyphenyl)propanoylamino]methyl]piperidine-1-carbonyl]phenyl] ethyl carbonate.
| Compound Name | [4-[4-[[3-(4-ethoxy-3-methoxyphenyl)propanoylamino]methyl]piperidine-1-carbonyl]phenyl] ethyl carbonate |
|---|---|
| PubChem CID | 108930100 |
| Molecular Formula | C28H36N2O7 |
| Molecular Weight | 512.60 g/mol |
| Exact Mass | 512.25 |
| IUPAC Name | [4-[4-[[3-(4-ethoxy-3-methoxyphenyl)propanoylamino]methyl]piperidine-1-carbonyl]phenyl] ethyl carbonate |
| SMILES | CCOC(=O)Oc1ccc(C(=O)N2CCC(CNC(=O)CCc3ccc(OCC)c(OC)c3)CC2)cc1 |
| InChI | InChI=1S/C28H36N2O7/c1-4-35-24-12-6-20(18-25(24)34-3)7-13-26(31)29-19-21-14-16-30(17-15-21)27(32)22-8-10-23(11-9-22)37-28(33)36-5-2/h6,8-12,18,21H,4-5,7,13-17,19H2,1-3H3,(H,29,31) |
| InChIKey | MKRMPGSGJBRTKJ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.60 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|