C29H32N2O7 — CID 108931691
[4-[[2-[[3-(4-ethoxy-3-methoxyphenyl)propanoylamino]methyl]phenyl]carbamoyl]phenyl] ethyl carbonate (PubChem CID 108931691) has the molecular formula C29H32N2O7 and a molecular weight of 520.58 g/mol. Its IUPAC name is [4-[[2-[[3-(4-ethoxy-3-methoxyphenyl)propanoylamino]methyl]phenyl]carbamoyl]phenyl] ethyl carbonate.
| Compound Name | [4-[[2-[[3-(4-ethoxy-3-methoxyphenyl)propanoylamino]methyl]phenyl]carbamoyl]phenyl] ethyl carbonate |
|---|---|
| PubChem CID | 108931691 |
| Molecular Formula | C29H32N2O7 |
| Molecular Weight | 520.58 g/mol |
| Exact Mass | 520.22 |
| IUPAC Name | [4-[[2-[[3-(4-ethoxy-3-methoxyphenyl)propanoylamino]methyl]phenyl]carbamoyl]phenyl] ethyl carbonate |
| SMILES | CCOC(=O)Oc1ccc(C(=O)Nc2ccccc2CNC(=O)CCc2ccc(OCC)c(OC)c2)cc1 |
| InChI | InChI=1S/C29H32N2O7/c1-4-36-25-16-10-20(18-26(25)35-3)11-17-27(32)30-19-22-8-6-7-9-24(22)31-28(33)21-12-14-23(15-13-21)38-29(34)37-5-2/h6-10,12-16,18H,4-5,11,17,19H2,1-3H3,(H,30,32)(H,31,33) |
| InChIKey | GVSGCEWQHCAVAC-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.58 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|