C18H24N6O — CID 94521674
(3S)-N-(cyclopropylmethyl)-1-[1-(4-methylphenyl)tetrazol-5-yl]piperidine-3-carboxamide (PubChem CID 94521674) has the molecular formula C18H24N6O and a molecular weight of 340.43 g/mol. Its IUPAC name is (3S)-N-(cyclopropylmethyl)-1-[1-(4-methylphenyl)tetrazol-5-yl]piperidine-3-carboxamide.
| Compound Name | (3S)-N-(cyclopropylmethyl)-1-[1-(4-methylphenyl)tetrazol-5-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 94521674 |
| Molecular Formula | C18H24N6O |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | (3S)-N-(cyclopropylmethyl)-1-[1-(4-methylphenyl)tetrazol-5-yl]piperidine-3-carboxamide |
| SMILES | Cc1ccc(-n2nnnc2N2CCC[C@H](C(=O)NCC3CC3)C2)cc1 |
| InChI | InChI=1S/C18H24N6O/c1-13-4-8-16(9-5-13)24-18(20-21-22-24)23-10-2-3-15(12-23)17(25)19-11-14-6-7-14/h4-5,8-9,14-15H,2-3,6-7,10-12H2,1H3,(H,19,25)/t15-/m0/s1 |
| InChIKey | YEXVPZAHYAGZHH-HNNXBMFYSA-N |
| XLogP | 1.71 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |