C19H21N7O — CID 47066462
N-(6-methyl-2-pyridinyl)-1-(1-phenyltetrazol-5-yl)piperidine-3-carboxamide (PubChem CID 47066462) has the molecular formula C19H21N7O and a molecular weight of 363.43 g/mol. Its IUPAC name is N-(6-methyl-2-pyridinyl)-1-(1-phenyltetrazol-5-yl)piperidine-3-carboxamide.
| Compound Name | N-(6-methyl-2-pyridinyl)-1-(1-phenyltetrazol-5-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 47066462 |
| Molecular Formula | C19H21N7O |
| Molecular Weight | 363.43 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | N-(6-methyl-2-pyridinyl)-1-(1-phenyltetrazol-5-yl)piperidine-3-carboxamide |
| SMILES | Cc1cccc(NC(=O)C2CCCN(c3nnnn3-c3ccccc3)C2)n1 |
| InChI | InChI=1S/C19H21N7O/c1-14-7-5-11-17(20-14)21-18(27)15-8-6-12-25(13-15)19-22-23-24-26(19)16-9-3-2-4-10-16/h2-5,7,9-11,15H,6,8,12-13H2,1H3,(H,20,21,27) |
| InChIKey | OAMWHLWKAHLQIN-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 88.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.43 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |