C15H19N5O2 — CID 122106801
5-methyl-1-[1-(4-methylphenyl)tetrazol-5-yl]piperidine-3-carboxylic acid (PubChem CID 122106801) has the molecular formula C15H19N5O2 and a molecular weight of 301.35 g/mol. Its IUPAC name is 5-methyl-1-[1-(4-methylphenyl)tetrazol-5-yl]piperidine-3-carboxylic acid.
| Compound Name | 5-methyl-1-[1-(4-methylphenyl)tetrazol-5-yl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122106801 |
| Molecular Formula | C15H19N5O2 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 5-methyl-1-[1-(4-methylphenyl)tetrazol-5-yl]piperidine-3-carboxylic acid |
| SMILES | Cc1ccc(-n2nnnc2N2CC(C)CC(C(=O)O)C2)cc1 |
| InChI | InChI=1S/C15H19N5O2/c1-10-3-5-13(6-4-10)20-15(16-17-18-20)19-8-11(2)7-12(9-19)14(21)22/h3-6,11-12H,7-9H2,1-2H3,(H,21,22) |
| InChIKey | MRNQEPFQQJYJQE-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |